Compound Q&A

What is Lithium 2-(2,2'-bipyridin-6-yl)phenolate (CAS: 1049805-81-3)?

Answer

Lithium 2-(2,2'-bipyridin-6-yl)phenolate
Lithium 2-(2,2'-bipyridin-6-yl)phenolate is a lithium compound with the formula LiC12H9N4. It is a coordination compound that can be used in various applications due to its unique chemical properties.

About

English Name Lithium 2-(2,2'-bipyridin-6-yl)phenolate
Molecular Formula C16H11LiN2O
Molecular Weight 254.21 g/mol
SMILES [Li+].c1ccc(c(c1)c2cccc(n2)c3ccccn3)[O-]
InChIKey GQLSFMBISHJIES-UHFFFAOYSA-M
Last Updated: 2026-03-18 18:36

Related Q&A

Compound Q&A

What are the main uses of Lithium 2-(2,2'-bipyridin-6-yl)phenolate (CAS: 1049805-81-3)?

Lithium 2-(2,2'-bipyridin-6-yl)phenolate is primarily used in pharmaceuticals for its anti-inflammat...

Compound Q&A

Is Lithium 2-(2,2'-bipyridin-6-yl)phenolate (CAS: 1049805-81-3) safe?

Lithium 2-(2,2'-bipyridin-6-yl)phenolate is generally considered safe when handled properly. However...

Compound Q&A

How should Lithium 2-(2,2'-bipyridin-6-yl)phenolate (CAS: 1049805-81-3) be stored?

Lithium 2-(2,2'-bipyridin-6-yl)phenolate should be stored in a cool, dry place away from direct sunl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...