Compound Q&A

What is (1S,2R)-4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3,5,5-trimethyl-3-cyclohexene-1,2-diol (CAS: 393862-19-6)?

Answer

(1S,2R)-4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3,5,5-trimethyl-3-cyclohexene-1,2-diol
This compound is a stereoisomer with a unique cyclic structure comprising a 3-cyclohexene-1,2-diol moiety along with a 3-hydroxy-1-buten-1-yl side chain. It is characterized by its trimethyl group and specific stereochemistry. This compound is used in pharmaceuticals and research due to its unique chemical properties.

About

English Name (1S,2R)-4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3,5,5-trimethyl-3-cyclohexene-1,2-diol
Molecular Formula C13H22O3
Molecular Weight 226.32 g/mol
SMILES CC1[C@@H](O)[C@@H](O)CC(C)(C)C=1/C=C/[C@@H](C)O
InChIKey HODWUFMHAGVDJY-QANURTJOSA-N
Last Updated: 2026-03-18 14:32

Related Q&A

Compound Q&A

What are the main uses of (1S,2R)-4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3,5,5-trimethyl-3-cyclohexene-1,2-diol (CAS: 393862-19-6)?

The compound is primarily used in pharmaceutical research and development, particularly in the synth...

Compound Q&A

Is (1S,2R)-4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3,5,5-trimethyl-3-cyclohexene-1,2-diol (CAS: 393862-19-6) safe?

The compound is generally considered safe when handled with appropriate precautions. However, it is ...

Compound Q&A

How should (1S,2R)-4-[(1E,3R)-3-Hydroxy-1-buten-1-yl]-3,5,5-trimethyl-3-cyclohexene-1,2-diol (CAS: 393862-19-6) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and sources of heat. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...