Compound Q&A

What is 4-[(3-Bromobenzyl)oxy]benzaldehyde (CAS: 588676-02-2)?

Answer

4-[(3-Bromobenzyl)oxy]benzaldehyde
4-[(3-Bromobenzyl)oxy]benzaldehyde is an aromatic organic compound with the CAS number 588676-02-2. It has a molecular formula of C14H10BrO2 and is characterized by its unique structure with a bromobenzyl group attached to a benzyloxy moiety. This compound is colorless to light yellow solid at room temperature, with a distinctive odor.

About

English Name 4-[(3-Bromobenzyl)oxy]benzaldehyde
Molecular Formula C14H11BrO2
Molecular Weight 291.14 g/mol
SMILES c1cc(cc(c1)Br)COc2ccc(cc2)C=O
InChIKey RNVLQBDBEJCTRG-UHFFFAOYSA-N
Last Updated: 2026-03-18 14:32

Related Q&A

Compound Q&A

What are the main uses of 4-[(3-Bromobenzyl)oxy]benzaldehyde (CAS: 588676-02-2)?

4-[(3-Bromobenzyl)oxy]benzaldehyde is primarily used in the synthesis of other organic compounds, ph...

Compound Q&A

Is 4-[(3-Bromobenzyl)oxy]benzaldehyde (CAS: 588676-02-2) safe?

4-[(3-Bromobenzyl)oxy]benzaldehyde is generally safe when handled with appropriate precautions. Howe...

Compound Q&A

How should 4-[(3-Bromobenzyl)oxy]benzaldehyde (CAS: 588676-02-2) be stored?

4-[(3-Bromobenzyl)oxy]benzaldehyde should be stored in a cool, dark place to prevent degradation. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...