Compound Q&A

What industries use 3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS: 94192-18-4)?

Answer

3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid
3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid finds applications in the pharmaceutical industry for its potential as a drug candidate. It is also used in the synthesis of various chemical intermediates and in the development of sensors and semiconductors due to its unique structural properties.

About

CAS No 94192-18-4
English Name 3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid
Molecular Formula C12H12N2O4
Molecular Weight 248.24 g/mol
SMILES COC1=CC=C(C=C1)C2=NOC(=N2)CCC(=O)O
InChIKey WRFNXLGYERRRTO-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS: 94192-18-4)?

3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid is a crystalline solid with a molecular w...

Compound Q&A

How is 3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS: 94192-18-4) typically synthesized?

3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid is usually synthesized via a multi-step p...

Compound Q&A

What precautions should be taken when handling 3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS: 94192-18-4)?

When handling 3-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid, it is important to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...