Compound Q&A

What industries use 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6)?

Answer

2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) is primarily used in the pharmaceutical industry for the synthesis of drug candidates. It can also be utilized in the development of polymers, sensors, and as a precursor in semiconductor manufacturing due to its unique chemical structure and reactivity.

About

CAS No 79099-00-6
English Name 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate
Molecular Formula C16H25N3O2
Molecular Weight 291.39500000000004 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)NC2=CC=CC=C2N
InChIKey QAMKZPZMTWAMLU-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6)?

2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) is a crystall...

Compound Q&A

How is 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) typically synthesized?

2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) can be synthe...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6)?

When handling 2-Methyl-2-proanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6),...

Compound Q&A

What are the main uses of (5-Sulfamoyl-3-pyridinyl)boronic acid (CAS: 951233-61-7)?

(5-Sulfamoyl-3-pyridinyl)boronic acid is primarily used in chemical synthesis, p...

951233-61-7(5-Sulfamoyl-3-pyrid...
Compound Q&A

How is Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate (CAS: 1942858-50-5) typically synthesized?

Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate is typically synthesized via est...

1942858-50-5Benzyl 2-methyl-2-(m...
Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use p...

209353-22-08-Fluoroquinolin-6-o...
Compound Q&A

What are the physical and chemical properties of 1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2)?

1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2) is a crystalline c...

129316-09-21,3-Dibromo-5-(2-met...