Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6)?

Answer

2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) is a crystalline solid with a molecular weight of approximately 294.36 g/mol. It has a pKa of about 5.0 and is slightly soluble in water. The compound is reactive towards bases and can undergo hydrolysis. It is soluble in common organic solvents such as methanol and ethanol.

About

CAS No 79099-00-6
English Name 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate
Molecular Formula C16H25N3O2
Molecular Weight 291.39500000000004 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)NC2=CC=CC=C2N
InChIKey QAMKZPZMTWAMLU-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) typically synthesized?

2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) can be synthe...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6)?

2-Methyl-2-propanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6) is primarily ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6)?

When handling 2-Methyl-2-proanyl 4-[(2-aminophenyl)amino]-1-piperidinecarboxylate (CAS: 79099-00-6),...

Compound Q&A

What are the main uses of (5-Sulfamoyl-3-pyridinyl)boronic acid (CAS: 951233-61-7)?

(5-Sulfamoyl-3-pyridinyl)boronic acid is primarily used in chemical synthesis, p...

951233-61-7(5-Sulfamoyl-3-pyrid...
Compound Q&A

How is Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate (CAS: 1942858-50-5) typically synthesized?

Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate is typically synthesized via est...

1942858-50-5Benzyl 2-methyl-2-(m...
Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use p...

209353-22-08-Fluoroquinolin-6-o...
Compound Q&A

What are the physical and chemical properties of 1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2)?

1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2) is a crystalline c...

129316-09-21,3-Dibromo-5-(2-met...