Compound Q&A

What industries use 4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 52034-38-5)?

Answer

4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid
4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid is used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It also finds applications in the polymer industry for enhancing the properties of certain polymer formulations. Additionally, it is utilized in the development of sensors and semiconductors, where its unique chemical properties contribute to its effectiveness.

About

CAS No 52034-38-5
English Name 4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid
Molecular Formula C14H13NO3
Molecular Weight 243.26 g/mol
SMILES CC1=CC(=C(N1C2=CC=C(C=C2)C(=O)O)C)C=O
InChIKey GPYVXQQXXCPCGK-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 52034-38-5)?

4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid is a crystalline solid with a molecular weight ...

Compound Q&A

How is 4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 52034-38-5) typically synthesized?

4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid is synthesized by a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling 4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 52034-38-5)?

When handling 4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid, it is important to use personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...