Compound Q&A

What industries use 2-Methyl-9,10-bis(phenylethynyl)anthracene (CAS: 51580-23-5)?

Answer

2-Methyl-9,10-bis(phenylethynyl)anthracene
2-Methyl-9,10-bis(phenylethynyl)anthracene is used in various industries. In pharmaceuticals, it serves as a precursor for the synthesis of certain drugs. In polymer science, it is used to create functionalized polymers with specific electronic properties. It also finds applications in the development of sensors due to its unique optical properties and in semiconductor technology where it can be used in organic electronics.

About

CAS No 51580-23-5
English Name 2-Methyl-9,10-bis(phenylethynyl)anthracene
Molecular Formula C31H20
Molecular Weight 392.5 g/mol
SMILES CC1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C#CC4=CC=CC=C4)C#CC5=CC=CC=C5
InChIKey KBIWITFMKHHGQY-UHFFFAOYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-9,10-bis(phenylethynyl)anthracene (CAS: 51580-23-5)?

2-Methyl-9,10-bis(phenylethynyl)anthracene is a solid with a crystalline form. It has a molecular we...

Compound Q&A

How is 2-Methyl-9,10-bis(phenylethynyl)anthracene (CAS: 51580-23-5) typically synthesized?

2-Methyl-9,10-bis(phenylethynyl)anthracene is synthesized through a multistep process involving the ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-9,10-bis(phenylethynyl)anthracene (CAS: 51580-23-5)?

When handling 2-Methyl-9,10-bis(phenylethynyl)anthracene, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...