Compound Q&A

How is Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3) typically synthesized?

Answer

Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate
Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate is typically synthesized by reacting benzyl isocyanate with 3-amino-cyclohexanol. The reaction occurs under mild conditions, often in the presence of a base such as triethylamine to enhance the nucleophilicity of the amino group. The yield is generally high, and the reaction is selective, leading to a single diastereomer of the product.

About

English Name Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate
Molecular Formula C14H20N2O2
Molecular Weight 248.32599999999994 g/mol
SMILES c1ccc(cc1)COC(=O)N[C@@H]2CCC[C@@H](C2)N
InChIKey NFWZARAFTINKJK-QWHCGFSZSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3)?

Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3) is a crystalline solid with a molecu...

Compound Q&A

What industries use Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3)?

Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3)?

When handling Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3), it is important to we...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...