Compound Q&A

What are the physical and chemical properties of Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3)?

Answer

Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate
Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3) is a crystalline solid with a molecular weight of approximately 278.36 g/mol. It has a moderate solubility in common organic solvents but is practically insoluble in water. The compound exhibits basic reactivity due to the aminocyclohexyl group, making it susceptible to nucleophilic substitution reactions.

About

English Name Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate
Molecular Formula C14H20N2O2
Molecular Weight 248.32599999999994 g/mol
SMILES c1ccc(cc1)COC(=O)N[C@@H]2CCC[C@@H](C2)N
InChIKey NFWZARAFTINKJK-QWHCGFSZSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

How is Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3) typically synthesized?

Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate is typically synthesized by reacting benzyl isocyanate w...

Compound Q&A

What industries use Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3)?

Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3)?

When handling Benzyl [(1R,3S)-3-aminocyclohexyl]carbamate (CAS: 1932063-48-3), it is important to we...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...