Compound Q&A

What are the physical and chemical properties of (6beta)-Spartein-2-one (CAS: 486-87-3)?

Answer

(6beta)-Spartein-2-one
(6beta)-Spartein-2-one is a crystalline compound with a molecular weight of approximately 300 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. Chemically, it is mildly reactive and can undergo esterification and reduction reactions. Its solubility and reactivity make it useful in various organic synthesis processes.

About

CAS No 486-87-3
English Name (6beta)-Spartein-2-one
Molecular Formula C15H24N2O
Molecular Weight 248.37 g/mol
SMILES C1CCN2C[C@@H]3C[C@H]([C@H]2C1)CN4[C@@H]3CCCC4=O
InChIKey JYIJIIVLEOETIQ-IGQOVBAYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

How is (6beta)-Spartein-2-one (CAS: 486-87-3) typically synthesized?

(6beta)-Spartein-2-one can be synthesized through the oxidation of sparteine, a naturally occurring ...

Compound Q&A

What industries use (6beta)-Spartein-2-one (CAS: 486-87-3)?

(6beta)-Spartein-2-one finds applications in the pharmaceutical industry as a precursor for drug syn...

Compound Q&A

What precautions should be taken when handling (6beta)-Spartein-2-one (CAS: 486-87-3)?

When handling (6beta)-Spartein-2-one, it is essential to wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...