Compound Q&A

How is Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) typically synthesized?

Answer

Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate
Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) is typically synthesized via a multi-step process involving bromination of a phenol, followed by a cycloaddition reaction and esterification. Commonly, the reaction involves the use of a Lewis acid catalyst such as aluminum bromide to control the regioselectivity and yield of the product, which is typically around 80-85%.

About

English Name Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate
Molecular Formula C12H13BrO3
Molecular Weight 285.13700000000006 g/mol
SMILES COC(=O)C1(CC(C1)O)c1ccc(cc1)Br
InChIKey AVVAISZYOOBGQS-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0)?

Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) is a white crystalline ...

Compound Q&A

What industries use Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0)?

Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) is used in the pharmace...

Compound Q&A

What precautions should be taken when handling Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0)?

When handling Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0), it is im...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...