Compound Q&A

What are the physical and chemical properties of Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0)?

Answer

Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate
Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) is a white crystalline solid with a molecular weight of approximately 315.03 g/mol. It has low solubility in water but is soluble in organic solvents such as ethanol and acetone. The compound is known for its reactivity, particularly towards nucleophiles, and can undergo esterification and nucleophilic substitution reactions.

About

English Name Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate
Molecular Formula C12H13BrO3
Molecular Weight 285.13700000000006 g/mol
SMILES COC(=O)C1(CC(C1)O)c1ccc(cc1)Br
InChIKey AVVAISZYOOBGQS-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) typically synthesized?

Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) is typically synthesize...

Compound Q&A

What industries use Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0)?

Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0) is used in the pharmace...

Compound Q&A

What precautions should be taken when handling Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0)?

When handling Methyl 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylate (CAS: 1432059-59-0), it is im...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...