Compound Q&A

How is 4-(Benzoylamino)-1-{5-O-[bis(4-methoxyphenyl)(phenyl)methyl]-2-deoxy-2-fluoro-beta-D-xylofuranosyl}-2(1H)-pyrimidinone (CAS: 146954-77-0) typically synthesized?

Answer

4-(Benzoylamino)-1-{5-O-[bis(4-methoxyphenyl)(phenyl)methyl]-2-deoxy-2-fluoro-beta-D-xylofuranosyl}-2(1H)-pyrimidinone
The compound is synthesized through a multi-step process involving the protection of the sugar moiety, followed by the introduction of the benzoyl group, and the subsequent installation of the fluoro substituent. The reaction typically requires the use of protecting groups such as acetals and is catalyzed by conditions that ensure high selectivity. The overall yield of the compound can range from 30% to 70%, depending on the specific reaction conditions.

About

English Name 4-(Benzoylamino)-1-{5-O-[bis(4-methoxyphenyl)(phenyl)methyl]-2-deoxy-2-fluoro-beta-D-xylofuranosyl}-2(1H)-pyrimidinone
Molecular Formula C37H34FN3O7
Molecular Weight 651.68 g/mol
SMILES COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H]([C@@H]([C@@H]1O)F)n1ccc(nc1=O)NC(=O)c1ccccc1
InChIKey RAIBEZUVTIPFOJ-NHASGABXSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What industries use 4-(Benzoylamino)-1-{5-O-[bis(4-methoxyphenyl)(phenyl)methyl]-2-deoxy-2-fluoro-beta-D-xylofuranosyl}-2(1H)-pyrimidinone (CAS: 146954-77-0)?

This compound is primarily used in the pharmaceutical industry as a key intermediate in the synthesi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...