Compound Q&A

How is (2-Hydroxy-1-naphthyl)boronic acid (CAS: 898257-48-2) typically synthesized?

Answer

(2-Hydroxy-1-naphthyl)boronic acid
(2-Hydroxy-1-naphthyl)boronic acid can be synthesized through the reduction of 2-naphthoquinone with a suitable reducing agent such as sodium borohydride. Alternatively, it can be prepared by the reaction of 1-naphthol with boron trichloride in the presence of an appropriate base. The yield and selectivity can be optimized using specific conditions and catalysts.

About

English Name (2-Hydroxy-1-naphthyl)boronic acid
Molecular Formula C10H9BO3
Molecular Weight 187.99099999999999 g/mol
SMILES B(C1=C(C=CC2=CC=CC=C12)O)(O)O
InChIKey GDVCCKPVARLVLL-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Hydroxy-1-naphthyl)boronic acid (CAS: 898257-48-2)?

(2-Hydroxy-1-naphthyl)boronic acid is a white to off-white crystalline solid with a molecular weight...

Compound Q&A

What industries use (2-Hydroxy-1-naphthyl)boronic acid (CAS: 898257-48-2)?

(2-Hydroxy-1-naphthyl)boronic acid finds applications in pharmaceuticals, where it can serve as a pr...

Compound Q&A

What precautions should be taken when handling (2-Hydroxy-1-naphthyl)boronic acid (CAS: 898257-48-2)?

When handling (2-Hydroxy-1-naphthyl)boronic acid, it is important to use appropriate personal protec...

Compound Q&A

What industries use 4-(4-tert-Butylphenyl)-1H-pyrazol-3-amine (CAS: 1015845-73-4)?

4-(4-tert-Butylphenyl)-1H-pyrazol-3-amine finds applications in various industri...

1015845-73-44-(4-tert-Butylpheny...
Compound Q&A

What industries use H3TATAB (CAS: 63557-10-8)?

H3TATAB is used in the pharmaceutical industry for the synthesis of certain orga...

63557-10-8H3TATAB
Compound Q&A

What are the main uses of 1-Ethyl-3-fluorobenzene (CAS: 696-39-9)?

1-Ethyl-3-fluorobenzene (CAS: 696-39-9) is primarily used as a precursor in the ...

696-39-91-Ethyl-3-fluorobenz...
Compound Q&A

What are the main uses of 1-(tert-Butoxycarbonyl)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (CAS: 851484-94-1)?

1-(tert-Butoxycarbonyl)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid is prim...

851484-94-11-(tert-Butoxycarbon...