Compound Q&A

What industries use 10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5)?

Answer

10-Hydroxyoleoside dimethyl ester
10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5) finds applications in the pharmaceutical industry, where it can be used as a precursor for the synthesis of more complex compounds. It may also be used in the polymer industry for certain specialized polymerization reactions. Its use in sensors and semiconductors is less common but possible due to its unique chemical properties.

About

CAS No 91679-27-5
English Name 10-Hydroxyoleoside dimethyl ester
Molecular Formula C18H26O12
Molecular Weight 434.39 g/mol
SMILES COC(=O)CC1C(=COC(C1=CCO)OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC
InChIKey ZJOVYMALVBUVMI-QHIFKACESA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5)?

10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5) is a white to off-white crystalline solid with a...

Compound Q&A

How is 10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5) typically synthesized?

10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5) is typically synthesized through the esterificat...

Compound Q&A

What precautions should be taken when handling 10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5)?

When handling 10-Hydroxyoleoside dimethyl ester (CAS: 91679-27-5), it is important to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...