Compound Q&A

What precautions should be taken when handling {[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 1533519-96-8)?

Answer

{[5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetic acid
When handling {[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 1533519-96-8), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place to prevent hydrolysis. Handle under a fume hood to avoid inhalation and ingestion. In case of a spill, immediately clean up using appropriate absorbent material, and consult a safety data sheet (SDS) for specific instructions. Ingestion, inhalation, or skin contact can be hazardous, so immediate medical attention is necessary if exposure occurs.

About

English Name {[5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetic acid
Molecular Formula C17H16BrN3O2S
Molecular Weight 406.31 g/mol
EINECS 604-604-1
SMILES CCCc1ccc(c2c1cccc2)n3c(nnc3Br)SCC(=O)O
InChIKey LEYOZDSJDRGGGV-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of {[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 1533519-96-8)?

{[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 1533519-96-8) i...

Compound Q&A

How is {[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 1533519-96-8) typically synthesized?

{[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 1533519-96-8) c...

Compound Q&A

What industries use {[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 1533519-96-8)?

The compound {[(5-Bromo-4-(4-propyl-1-naphthyl)-4H-1,2,4-triazol-3-yl)sulfanyl]acetic acid} (CAS: 15...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...