Compound Q&A

What precautions should be taken when handling 2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5)?

Answer

2-Bromo-7-chlorodibenzo[b,d]furan
When handling 2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5), ensure the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to prevent inhalation of vapors. Spills should be handled carefully with appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for specific spill procedures. Avoid contact with skin and eyes, and dispose of waste properly in accordance with local regulations.

About

English Name 2-Bromo-7-chlorodibenzo[b,d]furan
Molecular Formula C12H6BrClO
Molecular Weight 281.53 g/mol
SMILES ClC1C=C2OC3=CC=C(Br)C=C3C2=CC=1
InChIKey QCGWGYFVRUSBRM-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5)?

2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5) is a crystalline solid with a molecular weight...

Compound Q&A

How is 2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5) typically synthesized?

2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5) is typically synthesized via the bromination o...

Compound Q&A

What industries use 2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5)?

2-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2355229-03-5) is used in various industries, particularly in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...