Compound Q&A

How is Diethyl (2-thienylmethylene)malonate (CAS: 30313-06-5) typically synthesized?

Answer

Diethyl (2-thienylmethylene)malonate
Diethyl (2-thienylmethylene)malonate is typically synthesized via a condensation reaction between 2-thiophenecarboxaldehyde and ethyl malonate in the presence of an acid catalyst such as sulfuric acid. The reaction is carried out at elevated temperatures, and the yield is generally high, with selectivity towards the desired product.

About

CAS No 30313-06-5
English Name Diethyl (2-thienylmethylene)malonate
Molecular Formula C12H14O4S
Molecular Weight 254.31 g/mol
SMILES CCOC(=O)C(=CC1=CC=CS1)C(=O)OCC
InChIKey OUBXLQPLVCNKNN-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl (2-thienylmethylene)malonate (CAS: 30313-06-5)?

Diethyl (2-thienylmethylene)malonate is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use Diethyl (2-thienylmethylene)malonate (CAS: 30313-06-5)?

Diethyl (2-thienylmethylene)malonate finds applications in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling Diethyl (2-thienylmethylene)malonate (CAS: 30313-06-5)?

When handling Diethyl (2-thienylmethylene)malonate, it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...