Compound Q&A

What are the physical and chemical properties of (1S,2S,4R,9beta,16alpha)-1,2,20-Trihydroxy-9,10,14-trimethyl-11,22-dioxo-4,9-cyclo-9,10-secocholest-5-ene-16,25-diyl diacetate (CAS: 586960-44-3)?

Answer

(1S,2S,4R,9beta,16alpha)-1,2,20-Trihydroxy-9,10,14-trimethyl-11,22-dioxo-4,9-cyclo-9,10-secocholest-5-ene-16,25-diyl diacetate
This compound is a white to off-white crystalline solid with a high melting point. It has a molecular weight of approximately 558.64 g/mol. The compound is poorly soluble in water but soluble in organic solvents like methanol, ethanol, and acetone. It shows limited reactivity, with typical hydroxyl and ester groups making it prone to standard organic reactions such as ester hydrolysis and esterification. It is not flammable and does not readily undergo spontaneous decomposition under normal conditions.

About

English Name (1S,2S,4R,9beta,16alpha)-1,2,20-Trihydroxy-9,10,14-trimethyl-11,22-dioxo-4,9-cyclo-9,10-secocholest-5-ene-16,25-diyl diacetate
Molecular Formula C34H52O9
Molecular Weight 604.78 g/mol
SMILES C[C@@](O)([C@H]1[C@@H](C[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@H](O)[C@@H](O)C4(C)C)[C@]3(C)C(=O)C[C@@]21C)OC(C)=O)C(=O)CCC(C)(C)OC(C)=O
InChIKey VDLDNIIIESJMEV-NBFJMLLASA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

How is (1S,2S,4R,9beta,16alpha)-1,2,20-Trihydroxy-9,10,14-trimethyl-11,22-dioxo-4,9-cyclo-9,10-secocholest-5-ene-16,25-diyl diacetate (CAS: 586960-44-3) typically synthesized?

This compound is synthesized from cholestane derivatives through a series of chemical transformation...

Compound Q&A

What industries use (1S,2S,4R,9beta,16alpha)-1,2,20-Trihydroxy-9,10,14-trimethyl-11,22-dioxo-4,9-cyclo-9,10-secocholest-5-ene-16,25-diyl diacetate (CAS: 586960-44-3)?

This compound is primarily used in the pharmaceutical industry for the development of targeted drug ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...