Compound Q&A

How is 2-Nitro-4-(trifluoromethyl)benzamide (CAS: 22227-55-0) typically synthesized?

Answer

2-Nitro-4-(trifluoromethyl)benzamide
2-Nitro-4-(trifluoromethyl)benzamide is typically synthesized through the reaction of 4-(trifluoromethyl)benzoic acid with nitrous acid. The reaction is carried out under controlled conditions to ensure high selectivity and yield. Commonly, amines or amides are used as nucleophiles to introduce the nitro group, and the reaction is monitored using spectroscopic techniques for optimal conditions.

About

CAS No 22227-55-0
English Name 2-Nitro-4-(trifluoromethyl)benzamide
Molecular Formula C8H5F3N2O3
Molecular Weight 234.13 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])C(=O)N
InChIKey LIDIBDAQJHIRBO-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitro-4-(trifluoromethyl)benzamide (CAS: 22227-55-0)?

2-Nitro-4-(trifluoromethyl)benzamide is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use 2-Nitro-4-(trifluoromethyl)benzamide (CAS: 22227-55-0)?

2-Nitro-4-(trifluoromethyl)benzamide is used in pharmaceuticals for the synthesis of certain interme...

Compound Q&A

What precautions should be taken when handling 2-Nitro-4-(trifluoromethyl)benzamide (CAS: 22227-55-0)?

When handling 2-Nitro-4-(trifluoromethyl)benzamide, it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...