Compound Q&A

How is Chlorophosphonazo I (CAS: 1938-82-5) typically synthesized?

Answer

Chlorophosphonazo I
Chlorophosphonazo I (CAS: 1938-82-5) is typically synthesized by the reaction of phosphorus oxychloride with chlorophenol in the presence of a catalyst such as pyridine. The reaction involves the formation of a phosphonate ester, followed by the coupling of the phenolic hydroxyl group to form the azo compound. The yield is generally good, and the product can be isolated by filtration and recrystallization.

About

CAS No 1938-82-5
English Name Chlorophosphonazo I
Molecular Formula C16H12ClN2O11PS2
Molecular Weight 538.8 g/mol
SMILES C1=CC(=C(C=C1Cl)P(=O)(O)O)N=NC2=C(C3=C(C=C(C=C3C=C2S(=O)(=O)O)S(=O)(=O)O)O)O
InChIKey MEAUOUSSRBVKRD-UHFFFAOYSA-N
Last Updated: 2026-03-16 13:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chlorophosphonazo I (CAS: 1938-82-5)?

Chlorophosphonazo I (CAS: 1938-82-5) is a yellow crystalline compound with a molecular weight of app...

Compound Q&A

What industries use Chlorophosphonazo I (CAS: 1938-82-5)?

Chlorophosphonazo I (CAS: 1938-82-5) is used in various industries, including pharmaceuticals, where...

Compound Q&A

What precautions should be taken when handling Chlorophosphonazo I (CAS: 1938-82-5)?

When handling Chlorophosphonazo I (CAS: 1938-82-5), it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...