Compound Q&A

What is 6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0)?

Answer

6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline
6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0) is a complex organic compound with a unique molecular structure. It is characterized by its quinazoline ring system, featuring a bromo, chloro, and fluoro substituents. This compound is primarily used in pharmaceutical research and development due to its potential therapeutic applications.

About

English Name 6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline
Molecular Formula C14H7BrClFN2
Molecular Weight 337.58 g/mol
SMILES C1=CC(=CC=C1C2=NC3=C(C=C(C=C3)Br)C(=N2)Cl)F
InChIKey GIPACZKCRFSBRP-UHFFFAOYSA-N
Last Updated: 2026-03-16 08:50

Related Q&A

Compound Q&A

What are the main uses of 6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0)?

The main uses of 6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0) include its appli...

Compound Q&A

Is 6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0) safe?

6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0) is generally safe when handled wit...

Compound Q&A

How should 6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0) be stored?

6-Bromo-4-chloro-2-(4-fluorophenyl)quinazoline (CAS: 885277-35-0) should be stored in a cool, dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...