Compound Q&A

What are the main uses of 3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid (CAS: 77169-11-0)?

Answer

3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid
3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid is primarily used as an intermediate in the synthesis of other chemical compounds. It also finds applications in pharmaceuticals, where it can be used in the development of drugs. Additionally, it is utilized in research for its unique chemical properties.

About

CAS No 77169-11-0
English Name 3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid
Molecular Formula C11H10N2O2
Molecular Weight 202.21 g/mol
SMILES CC1=NN(C=C1C(=O)O)C2=CC=CC=C2
InChIKey XSSINBQIDAICII-UHFFFAOYSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What is 3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid (CAS: 77169-11-0)?

3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid is a chemical compound with the CAS number 77169-11-...

Compound Q&A

Is 3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid (CAS: 77169-11-0) safe?

3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid is generally considered safe when handled with prope...

Compound Q&A

How should 3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid (CAS: 77169-11-0) be stored?

3-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid should be stored in a tightly sealed container, prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...