Compound Q&A

What is 1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3)?

Answer

1-Phenylpyrrolidine-3-carboxylic acid
1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3) is an organic compound with the molecular formula C10H11NO2. It is characterized by its aromatic and amide functional groups, making it a versatile intermediate in organic synthesis. This compound is commonly used in the pharmaceutical industry for the synthesis of various drugs and bioactive compounds.

About

English Name 1-Phenylpyrrolidine-3-carboxylic acid
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES C1CN(CC1C(=O)O)C2=CC=CC=C2
InChIKey IOFLKIRLUFZCHR-UHFFFAOYSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What are the main uses of 1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3)?

1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3) is primarily used in the pharmaceutical ind...

Compound Q&A

Is 1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3) safe?

1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3) is generally safe when handled with appropr...

Compound Q&A

How should 1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3) be stored?

1-Phenylpyrrolidine-3-carboxylic acid (CAS: 933709-26-3) should be stored in tightly sealed containe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...