Compound Q&A

What is 2-(Carboxymethyl)-4,5-dimethoxybenzoic acid (CAS: 3809-00-5)?

Answer

2-(Carboxymethyl)-4,5-dimethoxybenzoic acid
2-(Carboxymethyl)-4,5-dimethoxybenzoic acid is a white or off-white crystalline powder. It is a derivative of benzoic acid with both methoxy and carboxymethyl groups substituents. This compound is often used as a precursor in pharmaceuticals and in the synthesis of other organic compounds.

About

CAS No 3809-00-5
English Name 2-(Carboxymethyl)-4,5-dimethoxybenzoic acid
Molecular Formula C11H12O6
Molecular Weight 240.21 g/mol
SMILES COC1=C(C=C(C(=C1)CC(=O)O)C(=O)O)OC
InChIKey NOUUHGZLGUYQON-UHFFFAOYSA-N
Last Updated: 2026-03-16 01:23

Related Q&A

Compound Q&A

What are the main uses of 2-(Carboxymethyl)-4,5-dimethoxybenzoic acid (CAS: 3809-00-5)?

2-(Carboxymethyl)-4,5-dimethoxybenzoic acid is primarily used as an intermediate in the synthesis of...

Compound Q&A

Is 2-(Carboxymethyl)-4,5-dimethoxybenzoic acid (CAS: 3809-00-5) safe?

2-(Carboxymethyl)-4,5-dimethoxybenzoic acid is generally considered safe under normal handling condi...

Compound Q&A

How should 2-(Carboxymethyl)-4,5-dimethoxybenzoic acid (CAS: 3809-00-5) be stored?

2-(Carboxymethyl)-4,5-dimethoxybenzoic acid should be stored in a cool, dry place away from direct s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...