Compound Q&A

Is 4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5) safe?

Answer

4-Chloro-3,5-dinitrobenzenesulfonic acid
4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5) is generally safe when handled with appropriate precautions. However, it can be corrosive and may cause skin and eye irritation. Proper personal protective equipment (PPE) should be worn, and it should be stored in a well-ventilated area to minimize inhalation risks.

About

CAS No 88-91-5
English Name 4-Chloro-3,5-dinitrobenzenesulfonic acid
Molecular Formula C6H3ClN2O7S
Molecular Weight 282.62 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])S(=O)(=O)O
InChIKey ALVPDCHBQRCKRQ-UHFFFAOYSA-N
Last Updated: 2026-03-15 21:48

Related Q&A

Compound Q&A

What is 4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5)?

4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5) is a chemical compound used in various appli...

Compound Q&A

What are the main uses of 4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5)?

4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5) is primarily used as a precursor in the synt...

Compound Q&A

How should 4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5) be stored?

4-Chloro-3,5-dinitrobenzenesulfonic acid (CAS: 88-91-5) should be stored in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...