Compound Q&A

What is Bis(2,4-dinitrophenyl)methanone (CAS: 71535-97-2)?

Answer

Bis(2,4-dinitrophenyl)methanone
Bis(2,4-dinitrophenyl)methanone, with CAS number 71535-97-2, is a yellow crystalline compound. It is highly stable under normal conditions and has a molecular formula of C14H8N4O6. This compound is known for its unique chemical structure and is used in various applications such as research and synthesis of other compounds.

About

CAS No 71535-97-2
English Name Bis(2,4-dinitrophenyl)methanone
Molecular Formula C13H6N4O9
Molecular Weight 362.21 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)C2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-]
InChIKey FAFWLBOSKDZHKI-UHFFFAOYSA-N
Last Updated: 2026-03-15 21:48

Related Q&A

Compound Q&A

What are the main uses of Bis(2,4-dinitrophenyl)methanone (CAS: 71535-97-2)?

Bis(2,4-dinitrophenyl)methanone (CAS: 71535-97-2) is primarily used in research for its reactivity a...

Compound Q&A

Is Bis(2,4-dinitrophenyl)methanone (CAS: 71535-97-2) safe?

Bis(2,4-dinitrophenyl)methanone (CAS: 71535-97-2) is generally safe under normal handling conditions...

Compound Q&A

How should Bis(2,4-dinitrophenyl)methanone (CAS: 71535-97-2) be stored?

Bis(2,4-dinitrophenyl)methanone (CAS: 71535-97-2) should be stored in a cool, dry place away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...