Compound Q&A

Is 4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5) safe?

Answer

4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl
4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5) should be handled with caution due to its chemical nature. Proper protective equipment such as gloves and goggles is recommended, and it should be stored away from heat and ignition sources. Safe handling practices are essential to minimize potential hazards.

About

English Name 4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl
Molecular Formula C13H7F4NO2
Molecular Weight 285.19 g/mol
SMILES C1=CC(=CC=C1C2=CC(=C(C=C2)F)C(F)(F)F)[N+](=O)[O-]
InChIKey BXRVWNWNFBLHPD-UHFFFAOYSA-N
Last Updated: 2026-03-15 21:48

Related Q&A

Compound Q&A

What is 4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5)?

4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5) is an organic compound with the mol...

Compound Q&A

What are the main uses of 4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5)?

4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5) is primarily used as an intermediat...

Compound Q&A

How should 4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5) be stored?

4-Fluoro-4'-nitro-3-(trifluoromethyl)biphenyl (CAS: 646054-51-5) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...