Compound Q&A

What are the main uses of Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3)?

Answer

Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate
Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3) is primarily used as a starting material in the synthesis of various pharmaceuticals and agrochemicals. It serves as a valuable intermediate in the production of drugs with anti-inflammatory, analgesic, and antitumor properties. Additionally, it is used in the development of novel materials and in academic research for studying the properties of chromene derivatives.

About

English Name Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate
Molecular Formula C12H11NO4
Molecular Weight 233.22 g/mol
SMILES CCOC(=O)C1=CC(=O)C2=C(O1)C(=CC=C2)N
InChIKey IWKNQOGLOVBSDJ-UHFFFAOYSA-N
Last Updated: 2026-03-15 21:48

Related Q&A

Compound Q&A

What is Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3)?

Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3) is an organic compound with the mol...

Compound Q&A

Is Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3) safe?

Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3) is generally considered safe for in...

Compound Q&A

How should Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3) be stored?

Ethyl 8-amino-4-oxo-4H-chromene-2-carboxylate (CAS: 103195-35-3) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...