Compound Q&A

What are the main uses of 4-Acetoxy-5-hydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 875535-36-7)?

Answer

4-Acetoxy-5-hydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid
This compound is primarily used in pharmaceuticals for its potential in synthesizing other chemical entities. It also finds applications in academic research for studying organic chemistry and material science.

About

English Name 4-Acetoxy-5-hydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid
Molecular Formula C17H10O7
Molecular Weight 326.26 g/mol
SMILES CC(=O)Oc1cc(cc2c1C(=O)c1c(C2=O)cccc1O)C(=O)O
InChIKey FRIXMWPJYKVOCV-UHFFFAOYSA-N
Last Updated: 2026-03-15 17:49

Related Q&A

Compound Q&A

What is 4-Acetoxy-5-hydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 875535-36-7)?

4-Acetoxy-5-hydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid is a complex organic compoun...

Compound Q&A

Is 4-Acetoxy-5-hydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 875535-36-7) safe?

Use of this compound requires caution. It is non-toxic but may cause skin irritation. Proper protect...

Compound Q&A

How should 4-Acetoxy-5-hydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 875535-36-7) be stored?

Store this compound in a cool, dry place away from direct sunlight. Use a tightly sealed container t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...