Compound Q&A

What is Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8)?

Answer

Fmoc-L-2-aminomethylphe(boc)
Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8) is a protected amino acid derivative used in solid-phase peptide synthesis. It contains an N-Methylphenylalanine (Fmoc) side chain with a 2-aminomethyl group attached to the phenyl ring.

About

English Name Fmoc-L-2-aminomethylphe(boc)
Molecular Formula C30H32N2O6
Molecular Weight 516.59 g/mol
SMILES O=C(N[C@H](C(=O)O)Cc1ccccc1CNC(=O)OC(C)(C)C)OCC1c2ccccc2c2c1cccc2
InChIKey SANGKBPWIFXZHS-SANMLTNESA-N
Last Updated: 2026-03-15 17:49

Related Q&A

Compound Q&A

What are the main uses of Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8)?

Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8) is primarily used in so...

Compound Q&A

Is Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8) safe?

Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8) is generally considered...

Compound Q&A

How should Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8) be stored?

Fmoc-L-2-aminomethylphenylcarbamic acid tert-butyl ester (CAS: 1217808-42-8) should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...