Compound Q&A

How should 2,6-Dichloro-5-nitro-4-pyrimidinamine (CAS: 31221-68-8) be stored?

Answer

2,6-Dichloro-5-nitro-4-pyrimidinamine
2,6-Dichloro-5-nitro-4-pyrimidinamine should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent exposure to air and moisture. Avoid storing it near incompatible materials to minimize the risk of chemical reactions. Maintain a temperature range of 15-25°C (59-77°F) for optimal stability.

About

CAS No 31221-68-8
English Name 2,6-Dichloro-5-nitro-4-pyrimidinamine
Molecular Formula C4H2Cl2N4O2
Molecular Weight 208.99 g/mol
SMILES C1(=C(N=C(N=C1Cl)Cl)N)[N+](=O)[O-]
InChIKey HTUHWWQWBOTDDW-UHFFFAOYSA-N
Last Updated: 2026-03-15 17:49

Related Q&A

Compound Q&A

What is 2,6-Dichloro-5-nitro-4-pyrimidinamine (CAS: 31221-68-8)?

2,6-Dichloro-5-nitro-4-pyrimidinamine (CAS: 31221-68-8) is a nitrogen-containing organic compound wi...

Compound Q&A

What are the main uses of 2,6-Dichloro-5-nitro-4-pyrimidinamine (CAS: 31221-68-8)?

2,6-Dichloro-5-nitro-4-pyrimidinamine is primarily used in chemical synthesis and research due to it...

Compound Q&A

Is 2,6-Dichloro-5-nitro-4-pyrimidinamine (CAS: 31221-68-8) safe?

2,6-Dichloro-5-nitro-4-pyrimidinamine can be handled with care under standard safety protocols. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...