Compound Q&A

What are the main uses of 2-Anilinoterephthalic acid (CAS: 566155-75-7)?

Answer

2-Anilinoterephthalic acid
2-Anilinoterephthalic acid is primarily used in the chemical industry for the synthesis of dyes and pigments. It also finds applications in pharmaceuticals, where it is used as a precursor in the production of certain drugs. Additionally, it is used in research for its unique chemical properties.

About

English Name 2-Anilinoterephthalic acid
Molecular Formula C14H11NO4
Molecular Weight 257.24 g/mol
SMILES OC(=O)c1ccc(c(c1)Nc1ccccc1)C(=O)O
InChIKey NGZJULVKWHXKMF-UHFFFAOYSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What is 2-Anilinoterephthalic acid (CAS: 566155-75-7)?

2-Anilinoterephthalic acid is a chemical compound with the CAS number 566155-75-7. It is an organic ...

Compound Q&A

Is 2-Anilinoterephthalic acid (CAS: 566155-75-7) safe?

2-Anilinoterephthalic acid is generally safe when handled with proper precautions. However, it shoul...

Compound Q&A

How should 2-Anilinoterephthalic acid (CAS: 566155-75-7) be stored?

2-Anilinoterephthalic acid should be stored in a cool, dry place away from heat and sources of ignit...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...