Compound Q&A

What is (R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8)?

Answer

(R)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate
(R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8) is a chiral organic compound used primarily in pharmaceutical research. It exhibits a piperidine ring fused to a phenyl ring with an amino group attached to the para position, and a tert-butyl group attached to the piperidine ring. This compound is known for its structural and functional properties that make it useful in the development of new drugs, particularly in the field of anti-inflammatory and antipsychotic medications.

About

English Name (R)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate
Molecular Formula C16H24N2O2
Molecular Weight 276.37 g/mol
SMILES Nc1ccc(cc1)[C@H]1CCCN(C1)C(=O)OC(C)(C)C
InChIKey SWUANUQBXJNXGP-ZDUSSCGKSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What are the main uses of (R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8)?

(R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8) is predominantly used i...

Compound Q&A

Is (R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8) safe?

(R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8) is generally considered...

Compound Q&A

How should (R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8) be stored?

(R)-tert-butyl 3-(4-aminophenyl)piperidine-1-carboxylate (CAS: 1263284-59-8) should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...