Compound Q&A

What are the main uses of 4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7)?

Answer

4-(1-Bromoethyl)benzoic acid
4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7) is primarily used in the synthesis of other organic compounds, particularly in the pharmaceutical industry. It serves as a starting material for preparing various brominated derivatives and is also used in research for its unique chemical properties.

About

English Name 4-(1-Bromoethyl)benzoic acid
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES CC(C1=CC=C(C=C1)C(=O)O)Br
InChIKey VICCYULHZWEWMB-UHFFFAOYSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What is 4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7)?

4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7) is an organic compound with the molecular formula C9...

Compound Q&A

Is 4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7) safe?

4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7) is generally safe when handled properly. However, it...

Compound Q&A

How should 4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7) be stored?

4-(1-Bromoethyl)benzoic acid (CAS: 113023-73-7) should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...