Compound Q&A

What are the main uses of 2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine (CAS: 163706-51-2)?

Answer

2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine
2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine is primarily used as a research tool in pharmacology and biochemistry. It can be used to study adenosine receptor agonist properties and as a potential therapeutic agent in various diseases.

About

English Name 2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine
Molecular Formula C13H16F3N5O4S
Molecular Weight 395.36 g/mol
SMILES FC(F)(F)CCSc1nc(c2ncn(c2n1)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)CO)N
InChIKey YXQSQDQDYVOJLV-IOSLPCCCSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What is 2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine (CAS: 163706-51-2)?

2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine is a derivative of adenosine with a trifluoropropyl sul...

Compound Q&A

Is 2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine (CAS: 163706-51-2) safe?

2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine is generally considered safe for laboratory use when pr...

Compound Q&A

How should 2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine (CAS: 163706-51-2) be stored?

2-[(3,3,3-Trifluoropropyl)sulfanyl]adenosine should be stored in a cool, dry place, protected from l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...