Compound Q&A

What is Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) (CAS: 212142-18-2)?

Answer

Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1)
Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) is a complex organic compound with the CAS number 212142-18-2. It is composed of succinic acid and phthalazinone derivatives, characterized by its structure and properties useful in pharmaceuticals and research applications. This compound has a molecular weight of approximately 465.18 g/mol and is known for its stability and versatility in various chemical reactions.

About

English Name Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1)
Molecular Formula C24H21ClN4O4
Molecular Weight 464.91 g/mol
SMILES C1=CC=C2C(=C1)C(=NN=C2NC3=CC=C(C=C3)Cl)CC4=CC=NC=C4.C(CC(=O)O)C(=O)O
InChIKey LLDWLPRYLVPDTG-UHFFFAOYSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What are the main uses of Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) (CAS: 212142-18-2)?

Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) is primarily used i...

Compound Q&A

Is Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) (CAS: 212142-18-2) safe?

Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) (CAS: 212142-18-2) ...

Compound Q&A

How should Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) (CAS: 212142-18-2) be stored?

Succinic acid - N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine (1:1) should be stored in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...