Compound Q&A

How should (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6) be stored?

Answer

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid
(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid should be stored in a tightly sealed container at room temperature between 15°C and 25°C. Avoid exposure to moisture and light. Store in a cool, dry place away from direct sunlight and heat sources. Ensure proper ventilation in the storage area to prevent the accumulation of fumes or vapors.

About

English Name (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid
Molecular Formula C11H18NO4-
Molecular Weight 228.26799999999994 g/mol
SMILES C[C@@H]1CN([C@H](C1)C(=O)[O-])C(=O)OC(C)(C)C
InChIKey MXKSXPYZNXUHEZ-JGVFFNPUSA-M
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What is (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is a chiral carboxylic acid derivative. It conta...

Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a building block in synthet...

Compound Q&A

Is (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6) safe?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is considered safe under normal handling conditi...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...