Compound Q&A

Is (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6) safe?

Answer

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid
(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is considered safe under normal handling conditions. However, it should be stored in a cool, dry place away from direct sunlight. Gloves and appropriate personal protective equipment (PPE) should be used during handling to prevent skin contact and inhalation of dust or vapors.

About

English Name (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid
Molecular Formula C11H18NO4-
Molecular Weight 228.26799999999994 g/mol
SMILES C[C@@H]1CN([C@H](C1)C(=O)[O-])C(=O)OC(C)(C)C
InChIKey MXKSXPYZNXUHEZ-JGVFFNPUSA-M
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What is (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is a chiral carboxylic acid derivative. It conta...

Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a building block in synthet...

Compound Q&A

How should (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6) be stored?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid should be stored in a tightly sealed container a...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...