Compound Q&A

Are there alternatives to 2,3,4,6-Tetraiodobenzoic acid in synthesis (CAS: 71463-71-3)?

Answer

2,3,4,6-Tetraiodobenzoic acid
While 2,3,4,6-Tetraiodobenzoic acid (CAS: 71463-71-3) is a specific compound with unique properties, there are alternative reagents for similar synthetic purposes, such as other benzoic acid derivatives with varying substituents. For instance, 2,4,6-Trichlorobenzoic acid or 2,4-Dinitrobenzoic acid can be used as alternatives depending on the specific reaction conditions and desired properties. These alternatives can be explored based on the need for iodine substitution or other functionalities.

About

CAS No 71463-71-3
English Name 2,3,4,6-Tetraiodobenzoic acid
Molecular Formula C7H2I4O2
Molecular Weight 625.71 g/mol
SMILES C1=C(C(=C(C(=C1I)I)I)C(=O)O)I
InChIKey BAUFQNBASVMUOB-UHFFFAOYSA-N
Last Updated: 2026-03-15 04:53

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,3,4,6-Tetraiodobenzoic acid (CAS: 71463-71-3)?

2,3,4,6-Tetraiodobenzoic acid (CAS: 71463-71-3) is regulated under the Globally Harmonized System of...

Compound Q&A

What is the market or research trend for 2,3,4,6-Tetraiodobenzoic acid (CAS: 71463-71-3)?

The market and research trends for 2,3,4,6-Tetraiodobenzoic acid (CAS: 71463-71-3) are primarily dri...

Compound Q&A

How should waste containing 2,3,4,6-Tetraiodobenzoic acid (CAS: 71463-71-3) be handled?

Waste containing 2,3,4,6-Tetraiodobenzoic acid (CAS: 71463-71-3) should be collected in leak-proof c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...