Compound Q&A

Are there alternatives to Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate in synthesis?

Answer

Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate
There are several alternatives to Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate (CAS: 672323-13-6) in synthesis, including other piperidine derivatives and similar functional groups. For example, benzyl 3-(3-hydroxy-3-oxopropanoyl)-1-piperidinecarboxylate or benzyl 3-(3-ethoxy-3-oxopropanoyl)-4-piperidinecarboxylate can often serve as effective substitutes. These alternatives can provide similar chemical properties and reactivity profiles, making them viable options in various synthetic routes.

About

English Name Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate
Molecular Formula C18H23NO5
Molecular Weight 333.38 g/mol
SMILES CCOC(=O)CC(=O)C1CCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey FYACXTJMCLJTLN-UHFFFAOYSA-N
Last Updated: 2026-03-15 04:53

Related Q&A

Compound Q&A

What regulatory guidelines apply to Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate (CAS: 672323-13-6)?

Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate (CAS: 672323-13-6) is regulated under the...

Compound Q&A

What is the market or research trend for Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate (CAS: 672323-13-6)?

The market for Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate (CAS: 672323-13-6) is curr...

Compound Q&A

How should waste containing Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate (CAS: 672323-13-6) be handled?

Waste containing Benzyl 3-(3-ethoxy-3-oxopropanoyl)-1-piperidinecarboxylate (CAS: 672323-13-6) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...