Compound Q&A

Are there alternatives to 4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5) in synthesis?

Answer

4-Amino-2-fluoro-5-nitrobenzonitrile
While 4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5) is a specific compound used in various synthetic applications, there are alternative reagents that can be used. For instance, 2-fluoro-5-nitrobenzonitrile without the amino group can serve as a precursor. Additionally, analogous compounds with similar functional groups, such as 4-hydroxy-2-fluoro-5-nitrobenzonitrile, can be explored. These alternatives can offer similar reactivity but with potentially different environmental and safety profiles.

About

English Name 4-Amino-2-fluoro-5-nitrobenzonitrile
Molecular Formula C7H4FN3O2
Molecular Weight 181.12 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])N)F)C#N
InChIKey XAHREBHCCFVAHU-UHFFFAOYSA-N
Last Updated: 2026-03-14 19:12

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5)?

4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5) is subject to various regulatory guidelines....

Compound Q&A

What is the market or research trend for 4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5)?

The market for 4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5) is driven by its applications...

Compound Q&A

How should waste containing 4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5) be handled?

Waste containing 4-Amino-2-fluoro-5-nitrobenzonitrile (CAS: 143151-03-5) should be handled with care...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...