Compound Q&A

How should (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6) be stored?

Answer

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid
(2,4-Difluoro-3-isopropoxyphenyl)boronic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption and degradation.

About

English Name (2,4-Difluoro-3-isopropoxyphenyl)boronic acid
Molecular Formula C9H11BF2O3
Molecular Weight 215.992 g/mol
SMILES CC(Oc1c(F)ccc(c1F)B(O)O)C
InChIKey LTXLJWCQTYVYCS-UHFFFAOYSA-N
Last Updated: 2026-03-14 19:12

Related Q&A

Compound Q&A

What is (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is an organoboron compound with a molecular formula C8...

Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synthesis for its reactiv...

Compound Q&A

Is (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6) safe?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is generally safe when handled with appropriate safety...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...