Compound Q&A

Is (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6) safe?

Answer

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid
(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is generally safe when handled with appropriate safety precautions. It is important to follow MSDS guidelines and use personal protective equipment such as gloves and goggles to minimize exposure.

About

English Name (2,4-Difluoro-3-isopropoxyphenyl)boronic acid
Molecular Formula C9H11BF2O3
Molecular Weight 215.992 g/mol
SMILES CC(Oc1c(F)ccc(c1F)B(O)O)C
InChIKey LTXLJWCQTYVYCS-UHFFFAOYSA-N
Last Updated: 2026-03-14 19:12

Related Q&A

Compound Q&A

What is (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is an organoboron compound with a molecular formula C8...

Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synthesis for its reactiv...

Compound Q&A

How should (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6) be stored?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid should be stored in a cool, dry place, away from direc...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...