Compound Q&A

What are the main uses of Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) (CAS: 587-23-5)?

Answer

Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1)
Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) is primarily used in the pharmaceutical industry for drug development, particularly as a potential intermediate or active ingredient. It also has applications in the fine chemicals sector, where it can be used as a reagent or starting material in various syntheses. Additionally, it finds use in research as a model compound for studying specific chemical interactions and properties.

About

CAS No 587-23-5
English Name Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1)
Molecular Formula C14H20N4O3
Molecular Weight 292.34 g/mol
SMILES C1N2CN3CN1CN(C2)C3.C1=CC=C(C=C1)C(C(=O)O)O
InChIKey UXNFIJPHRQEWRQ-UHFFFAOYSA-N
Last Updated: 2026-03-14 19:12

Related Q&A

Compound Q&A

What is Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) (CAS: 587-23-5)?

Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) is a complex organic...

Compound Q&A

Is Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) (CAS: 587-23-5) safe?

Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) (CAS: 587-23-5) is g...

Compound Q&A

How should Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) (CAS: 587-23-5) be stored?

Hydroxy(phenyl)acetic acid - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) (CAS: 587-23-5) shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...