Compound Q&A

What is the market or research trend for 4-[(2,6-Dichlorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid (CAS: 825619-04-3)?

Answer

4-[(2,6-Dichlorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid
The compound is gaining research interest in pharmaceutical and chemical industries due to its potential in drug development. Market trends indicate increasing demand for its use in synthesizing new chemical entities with specific biological activities, particularly in antifungal and antibacterial research.

About

English Name 4-[(2,6-Dichlorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid
Molecular Formula C11H7Cl2N3O3
Molecular Weight 300.10100000000006 g/mol
SMILES O=C(C(C(Cl)=CC=C1)=C1Cl)NC2=CNN=C2C(O)=O
InChIKey BRZQYVXJAZMSBB-UHFFFAOYSA-N
Last Updated: 2026-03-12 04:32

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-[(2,6-Dichlorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid (CAS: 825619-04-3)?

This compound falls under various regulatory guidelines including GHS (Global Harmonized System of C...

Compound Q&A

Are there alternatives to 4-[(2,6-Dichlorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid (CAS: 825619-04-3) in synthesis?

Several alternatives can be used in synthesis, such as other acid derivatives or related pyrazole co...

Compound Q&A

How should waste containing 4-[(2,6-Dichlorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid (CAS: 825619-04-3) be handled?

Waste containing this compound should be collected in appropriate containers, labeled with hazard wa...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene