Compound Q&A

Are there alternatives to cis-2-cyanocyclopropanecarboxylic acid in synthesis?

Answer

cis-2-cyanocyclopropanecarboxylic acid
Yes, there are alternatives to cis-2-cyanocyclopropanecarboxylic acid (CAS: 74650-11-6) in synthesis. Common alternatives include other cyanocyclopropanecarboxylic acids with different isomers or analogs, such as trans-2-cyanocyclopropanecarboxylic acid. These can be used depending on the specific reaction conditions and desired outcomes. Other reagents like acrylonitrile can also serve as precursors in alternative synthesis routes.

About

CAS No 74650-11-6
English Name cis-2-cyanocyclopropanecarboxylic acid
Molecular Formula C5H5NO2
Molecular Weight 111.1 g/mol
SMILES O=C([C@H]1[C@@H](C#N)C1)O
InChIKey MFCBCXRMDAOFOT-QWWZWVQMSA-N
Last Updated: 2026-03-11 23:39

Related Q&A

Compound Q&A

What regulatory guidelines apply to cis-2-cyanocyclopropanecarboxylic acid (CAS: 74650-11-6)?

cis-2-Cyanocyclopropanecarboxylic acid (CAS: 74650-11-6) is regulated under various guidelines. It f...

Compound Q&A

What is the market or research trend for cis-2-cyanocyclopropanecarboxylic acid (CAS: 74650-11-6)?

The market for cis-2-cyanocyclopropanecarboxylic acid (CAS: 74650-11-6) is relatively niche but show...

Compound Q&A

How should waste containing cis-2-cyanocyclopropanecarboxylic acid (CAS: 74650-11-6) be handled?

Waste containing cis-2-cyanocyclopropanecarboxylic acid (CAS: 74650-11-6) should be handled in accor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...