Compound Q&A

Are there alternatives to 5-[3-(Trifluoromethyl)phenyl]nicotinic acid (CAS: 893740-46-0) in synthesis?

Answer

5-[3-(Trifluoromethyl)phenyl]nicotinic acid
There are alternative reagents and methods that can be used in the synthesis of 5-[3-(Trifluoromethyl)phenyl]nicotinic acid (CAS: 893740-46-0). For instance, using other substituted nicotinic acids or utilizing different synthetic pathways can be explored based on the specific requirements of the reaction and the desired product properties.

About

English Name 5-[3-(Trifluoromethyl)phenyl]nicotinic acid
Molecular Formula C13H8F3NO2
Molecular Weight 267.21 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)C2=CC(=CN=C2)C(=O)O
InChIKey XPOWGSBZIKCQTP-UHFFFAOYSA-N
Last Updated: 2026-03-11 17:53

Related Q&A

Compound Q&A

What regulatory guidelines apply to 5-[3-(Trifluoromethyl)phenyl]nicotinic acid (CAS: 893740-46-0)?

5-[3-(Trifluoromethyl)phenyl]nicotinic acid is subject to various regulatory guidelines including GH...

Compound Q&A

What is the market or research trend for 5-[3-(Trifluoromethyl)phenyl]nicotinic acid (CAS: 893740-46-0)?

The market for 5-[3-(Trifluoromethyl)phenyl]nicotinic acid (CAS: 893740-46-0) is growing due to its ...

Compound Q&A

How should waste containing 5-[3-(Trifluoromethyl)phenyl]nicotinic acid (CAS: 893740-46-0) be handled?

Waste containing 5-[3-(Trifluoromethyl)phenyl]nicotinic acid (CAS: 893740-46-0) should be handled ac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...