Compound Q&A

Are there alternatives to (2S)-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(4-hydroxycyclohexyl)acetic acid in synthesis?

Answer

(2S)-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(4-hydroxycyclohexyl)acetic acid
Alternatives in synthesis include using similar fluorenyl protected amino acids or other substituted amino acids. Common reagents like Boc-protected derivatives or other reactive intermediates can be used as substitutes depending on the specific application and reaction conditions.

About

English Name (2S)-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(4-hydroxycyclohexyl)acetic acid
Molecular Formula C23H25NO5
Molecular Weight 395.46 g/mol
SMILES c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@@H](C4CCC(CC4)O)C(=O)O
InChIKey LDKHGFYFIBBLAC-XFMWISLNSA-N
Last Updated: 2026-03-11 17:53

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2S)-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(4-hydroxycyclohexyl)acetic acid (CAS: 1416444-92-2)?

This compound is subject to various regulatory guidelines such as GHS for classification and labelin...

Compound Q&A

What is the market or research trend for (2S)-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(4-hydroxycyclohexyl)acetic acid (CAS: 1416444-92-2)?

The market and research trend for this compound reflects growing interest in fluorenyl protected ami...

Compound Q&A

How should waste containing (2S)-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}(4-hydroxycyclohexyl)acetic acid (CAS: 1416444-92-2) be handled?

Waste containing this compound should be collected in appropriate containers, labeled with the corre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...